توجه: محتویات این صفحه به صورت خودکار پردازش شده و مقاله‌های نویسندگانی با تشابه اسمی، همگی در بخش یکسان نمایش داده می‌شوند.
۱Synthesis and Crystal Structure of Cd(2)(picOH)(4)Cl(2)(H(2)O)(2)
نویسنده(ها): ، ، ،
اطلاعات انتشار: پانزدهمین همایش انجمن بلورشناسی و کانی شناسی ایران، سال
تعداد صفحات: ۴
The title complex, Cd(2)(picOH)(4)Cl(2)(H(2)O)(2), was synthesized and characterized by elemental analysis, IR and X–Ray diffraction analysis. Crystallography studies showthat the Cd ion is octahedrally coordinated to two chlorine atoms, one water molecule and N and O atoms in one picOH– ligand and one O atom in the other picOH– ligand.Crystal structures of complexe show a weak bonding interaction between the metal and the hydroxyl oxygen groups.<\div>
نمایش نتایج ۱ تا ۱ از میان ۱ نتیجه